C19H28N4O3S — CID 146041276
1,3-dimethyl-5-(4-piperidin-4-ylpiperidin-1-yl)sulfonylbenzimidazol-2-one (PubChem CID 146041276) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 1,3-dimethyl-5-(4-piperidin-4-ylpiperidin-1-yl)sulfonylbenzimidazol-2-one.
| Compound Name | 1,3-dimethyl-5-(4-piperidin-4-ylpiperidin-1-yl)sulfonylbenzimidazol-2-one |
|---|---|
| PubChem CID | 146041276 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 1,3-dimethyl-5-(4-piperidin-4-ylpiperidin-1-yl)sulfonylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(S(=O)(=O)N3CCC(C4CCNCC4)CC3)ccc21 |
| InChI | InChI=1S/C19H28N4O3S/c1-21-17-4-3-16(13-18(17)22(2)19(21)24)27(25,26)23-11-7-15(8-12-23)14-5-9-20-10-6-14/h3-4,13-15,20H,5-12H2,1-2H3 |
| InChIKey | JBAXVQZUTAKIQE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |