C14H20N4O3S — CID 119959710
5-(3-aminopiperidin-1-yl)sulfonyl-1,3-dimethylbenzimidazol-2-one (PubChem CID 119959710) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is 5-(3-aminopiperidin-1-yl)sulfonyl-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-(3-aminopiperidin-1-yl)sulfonyl-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 119959710 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 5-(3-aminopiperidin-1-yl)sulfonyl-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(S(=O)(=O)N3CCCC(N)C3)ccc21 |
| InChI | InChI=1S/C14H20N4O3S/c1-16-12-6-5-11(8-13(12)17(2)14(16)19)22(20,21)18-7-3-4-10(15)9-18/h5-6,8,10H,3-4,7,9,15H2,1-2H3 |
| InChIKey | STPSTNBXUYCEAS-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |