C13H16F2N2O2S — CID 43598067
1-(3,5-difluorophenyl)sulfonyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 43598067) has the molecular formula C13H16F2N2O2S and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)sulfonyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | 1-(3,5-difluorophenyl)sulfonyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 43598067 |
| Molecular Formula | C13H16F2N2O2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-(3,5-difluorophenyl)sulfonyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | CC1CC2CNCC2N1S(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H16F2N2O2S/c1-8-2-9-6-16-7-13(9)17(8)20(18,19)12-4-10(14)3-11(15)5-12/h3-5,8-9,13,16H,2,6-7H2,1H3 |
| InChIKey | QBKGVBBRTJRSGH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |