C13H33ClN5O4S2+ — CID 158798691
N,N-dimethylpiperazine-1-sulfonamide;dimethylsulfamoylchloranium;piperidine (PubChem CID 158798691) has the molecular formula C13H33ClN5O4S2+ and a molecular weight of 423.03 g/mol. Its IUPAC name is N,N-dimethylpiperazine-1-sulfonamide;dimethylsulfamoylchloranium;piperidine.
| Compound Name | N,N-dimethylpiperazine-1-sulfonamide;dimethylsulfamoylchloranium;piperidine |
|---|---|
| PubChem CID | 158798691 |
| Molecular Formula | C13H33ClN5O4S2+ |
| Molecular Weight | 423.03 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N,N-dimethylpiperazine-1-sulfonamide;dimethylsulfamoylchloranium;piperidine |
| SMILES | C1CCNCC1.CN(C)S(=O)(=O)N1CCNCC1.CN(C)S(=O)(=O)[ClH+] |
| InChI | InChI=1S/C6H15N3O2S.C5H11N.C2H7ClNO2S/c1-8(2)12(10,11)9-5-3-7-4-6-9;1-2-4-6-5-3-1;1-4(2)7(3,5)6/h7H,3-6H2,1-2H3;6H,1-5H2;3H,1-2H3/q;;+1 |
| InChIKey | ITETUSLRMUEPDG-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.03 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |