C10H21N3O2S2 — CID 43296839
N-methyl-N-(thiolan-3-yl)-1,4-diazepane-1-sulfonamide (PubChem CID 43296839) has the molecular formula C10H21N3O2S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is N-methyl-N-(thiolan-3-yl)-1,4-diazepane-1-sulfonamide.
| Compound Name | N-methyl-N-(thiolan-3-yl)-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 43296839 |
| Molecular Formula | C10H21N3O2S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-methyl-N-(thiolan-3-yl)-1,4-diazepane-1-sulfonamide |
| SMILES | CN(C1CCSC1)S(=O)(=O)N1CCCNCC1 |
| InChI | InChI=1S/C10H21N3O2S2/c1-12(10-3-8-16-9-10)17(14,15)13-6-2-4-11-5-7-13/h10-11H,2-9H2,1H3 |
| InChIKey | IUCNASSHKLEYDM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |