C12H21N3O2S — CID 43297009
2-(1,4-diazepan-1-yl)-N-methyl-2-oxo-N-(thiolan-3-yl)acetamide (PubChem CID 43297009) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-methyl-2-oxo-N-(thiolan-3-yl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-methyl-2-oxo-N-(thiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 43297009 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-methyl-2-oxo-N-(thiolan-3-yl)acetamide |
| SMILES | CN(C(=O)C(=O)N1CCCNCC1)C1CCSC1 |
| InChI | InChI=1S/C12H21N3O2S/c1-14(10-3-8-18-9-10)11(16)12(17)15-6-2-4-13-5-7-15/h10,13H,2-9H2,1H3 |
| InChIKey | UXHZWKVNOWHFRB-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|