C10H16F3N3O2 — CID 60890278
2-(1,4-diazepan-1-yl)-N-methyl-2-oxo-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 60890278) has the molecular formula C10H16F3N3O2 and a molecular weight of 267.25 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-methyl-2-oxo-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-methyl-2-oxo-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 60890278 |
| Molecular Formula | C10H16F3N3O2 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-methyl-2-oxo-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CN(CC(F)(F)F)C(=O)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C10H16F3N3O2/c1-15(7-10(11,12)13)8(17)9(18)16-5-2-3-14-4-6-16/h14H,2-7H2,1H3 |
| InChIKey | ZKDDRRZXHLAKQV-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|