C11H19N5O4 — CID 62922120
N,N-bis(2-amino-2-oxoethyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide (PubChem CID 62922120) has the molecular formula C11H19N5O4 and a molecular weight of 285.30 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 62922120 |
| Molecular Formula | C11H19N5O4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C11H19N5O4/c12-8(17)6-16(7-9(13)18)11(20)10(19)15-4-1-2-14-3-5-15/h14H,1-7H2,(H2,12,17)(H2,13,18) |
| InChIKey | YIGQMLLZMHTFKH-UHFFFAOYSA-N |
| XLogP | -3.39 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|