C12H25N3S — CID 62832766
N-[2-(1,4-diazepan-1-yl)ethyl]-N-methylthiolan-3-amine (PubChem CID 62832766) has the molecular formula C12H25N3S and a molecular weight of 243.42 g/mol. Its IUPAC name is N-[2-(1,4-diazepan-1-yl)ethyl]-N-methylthiolan-3-amine.
| Compound Name | N-[2-(1,4-diazepan-1-yl)ethyl]-N-methylthiolan-3-amine |
|---|---|
| PubChem CID | 62832766 |
| Molecular Formula | C12H25N3S |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-[2-(1,4-diazepan-1-yl)ethyl]-N-methylthiolan-3-amine |
| SMILES | CN(CCN1CCCNCC1)C1CCSC1 |
| InChI | InChI=1S/C12H25N3S/c1-14(12-3-10-16-11-12)8-9-15-6-2-4-13-5-7-15/h12-13H,2-11H2,1H3 |
| InChIKey | XMVUXGLJTHDNGX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |