C9H22N4O4S2 — CID 7372045
(2S)-1-N,1-N,4-N,4-N,2-pentamethylpiperazine-1,4-disulfonamide (PubChem CID 7372045) has the molecular formula C9H22N4O4S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S)-1-N,1-N,4-N,4-N,2-pentamethylpiperazine-1,4-disulfonamide.
| Compound Name | (2S)-1-N,1-N,4-N,4-N,2-pentamethylpiperazine-1,4-disulfonamide |
|---|---|
| PubChem CID | 7372045 |
| Molecular Formula | C9H22N4O4S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (2S)-1-N,1-N,4-N,4-N,2-pentamethylpiperazine-1,4-disulfonamide |
| SMILES | C[C@H]1CN(S(=O)(=O)N(C)C)CCN1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H22N4O4S2/c1-9-8-12(18(14,15)10(2)3)6-7-13(9)19(16,17)11(4)5/h9H,6-8H2,1-5H3/t9-/m0/s1 |
| InChIKey | NCTCFUATJONAFK-VIFPVBQESA-N |
| XLogP | -1.39 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |