C13H19FN2O2S — CID 95632290
(2S,4R)-4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide (PubChem CID 95632290) has the molecular formula C13H19FN2O2S and a molecular weight of 286.37 g/mol. Its IUPAC name is (2S,4R)-4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide.
| Compound Name | (2S,4R)-4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 95632290 |
| Molecular Formula | C13H19FN2O2S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2S,4R)-4-(4-fluorophenyl)-N,N,2-trimethylpyrrolidine-1-sulfonamide |
| SMILES | C[C@H]1C[C@H](c2ccc(F)cc2)CN1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H19FN2O2S/c1-10-8-12(11-4-6-13(14)7-5-11)9-16(10)19(17,18)15(2)3/h4-7,10,12H,8-9H2,1-3H3/t10-,12-/m0/s1 |
| InChIKey | GUXTXYTVRQHKNX-JQWIXIFHSA-N |
| XLogP | 1.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |