C12H17FN2O3S — CID 110663884
3-(4-fluorophenyl)-N,N-dimethylmorpholine-4-sulfonamide (PubChem CID 110663884) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N,N-dimethylmorpholine-4-sulfonamide.
| Compound Name | 3-(4-fluorophenyl)-N,N-dimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 110663884 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-(4-fluorophenyl)-N,N-dimethylmorpholine-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCOCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FN2O3S/c1-14(2)19(16,17)15-7-8-18-9-12(15)10-3-5-11(13)6-4-10/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | IJXYREQKMWRLGI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |