C18H20FNO3S — CID 110871749
4-(3,4-dimethylphenyl)sulfonyl-3-(4-fluorophenyl)morpholine (PubChem CID 110871749) has the molecular formula C18H20FNO3S and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)sulfonyl-3-(4-fluorophenyl)morpholine.
| Compound Name | 4-(3,4-dimethylphenyl)sulfonyl-3-(4-fluorophenyl)morpholine |
|---|---|
| PubChem CID | 110871749 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-(3,4-dimethylphenyl)sulfonyl-3-(4-fluorophenyl)morpholine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C18H20FNO3S/c1-13-3-8-17(11-14(13)2)24(21,22)20-9-10-23-12-18(20)15-4-6-16(19)7-5-15/h3-8,11,18H,9-10,12H2,1-2H3 |
| InChIKey | GPAYMSGFDVYKTH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |