C15H15FN2O3S — CID 154763427
3-(3-fluorophenyl)-4-pyridin-4-ylsulfonylmorpholine (PubChem CID 154763427) has the molecular formula C15H15FN2O3S and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-4-pyridin-4-ylsulfonylmorpholine.
| Compound Name | 3-(3-fluorophenyl)-4-pyridin-4-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 154763427 |
| Molecular Formula | C15H15FN2O3S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-(3-fluorophenyl)-4-pyridin-4-ylsulfonylmorpholine |
| SMILES | O=S(=O)(c1ccncc1)N1CCOCC1c1cccc(F)c1 |
| InChI | InChI=1S/C15H15FN2O3S/c16-13-3-1-2-12(10-13)15-11-21-9-8-18(15)22(19,20)14-4-6-17-7-5-14/h1-7,10,15H,8-9,11H2 |
| InChIKey | BPVUDRKCYUZICL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |