C10H21N3O3S — CID 124896412
(4aS,8aR)-4a-hydroxy-N,N-dimethyl-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridine-2-sulfonamide (PubChem CID 124896412) has the molecular formula C10H21N3O3S and a molecular weight of 263.36 g/mol. Its IUPAC name is (4aS,8aR)-4a-hydroxy-N,N-dimethyl-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridine-2-sulfonamide.
| Compound Name | (4aS,8aR)-4a-hydroxy-N,N-dimethyl-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridine-2-sulfonamide |
|---|---|
| PubChem CID | 124896412 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (4aS,8aR)-4a-hydroxy-N,N-dimethyl-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridine-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CC[C@@]2(O)CCNC[C@@H]2C1 |
| InChI | InChI=1S/C10H21N3O3S/c1-12(2)17(15,16)13-6-4-10(14)3-5-11-7-9(10)8-13/h9,11,14H,3-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | SWGUOGNOYNFCJR-ZJUUUORDSA-N |
| XLogP | -1.16 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |