C23H29N3O2 — CID 156609624
(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl)-[4-[2-(dimethylamino)phenyl]phenyl]methanone (PubChem CID 156609624) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl)-[4-[2-(dimethylamino)phenyl]phenyl]methanone.
| Compound Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl)-[4-[2-(dimethylamino)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 156609624 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl)-[4-[2-(dimethylamino)phenyl]phenyl]methanone |
| SMILES | CN(C)c1ccccc1-c1ccc(C(=O)N2CCC3(O)CCNCC3C2)cc1 |
| InChI | InChI=1S/C23H29N3O2/c1-25(2)21-6-4-3-5-20(21)17-7-9-18(10-8-17)22(27)26-14-12-23(28)11-13-24-15-19(23)16-26/h3-10,19,24,28H,11-16H2,1-2H3 |
| InChIKey | QAQSYUWIELTIMQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |