C21H23FN2O2 — CID 72850012
[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-[3-(3-fluorophenyl)phenyl]methanone (PubChem CID 72850012) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-[3-(3-fluorophenyl)phenyl]methanone.
| Compound Name | [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-[3-(3-fluorophenyl)phenyl]methanone |
|---|---|
| PubChem CID | 72850012 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-[3-(3-fluorophenyl)phenyl]methanone |
| SMILES | O=C(c1cccc(-c2cccc(F)c2)c1)N1CC[C@@]2(O)CCNC[C@H]2C1 |
| InChI | InChI=1S/C21H23FN2O2/c22-19-6-2-4-16(12-19)15-3-1-5-17(11-15)20(25)24-10-8-21(26)7-9-23-13-18(21)14-24/h1-6,11-12,18,23,26H,7-10,13-14H2/t18-,21-/m0/s1 |
| InChIKey | QSTIKFHJKOXRDA-RXVVDRJESA-N |
| XLogP | 2.68 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |