C20H23ClFN3O2 — CID 154903974
[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-[3-(3-fluoro-2-pyridinyl)phenyl]methanone;hydrochloride (PubChem CID 154903974) has the molecular formula C20H23ClFN3O2 and a molecular weight of 391.87 g/mol. Its IUPAC name is [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-[3-(3-fluoro-2-pyridinyl)phenyl]methanone;hydrochloride.
| Compound Name | [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-[3-(3-fluoro-2-pyridinyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 154903974 |
| Molecular Formula | C20H23ClFN3O2 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-[3-(3-fluoro-2-pyridinyl)phenyl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1cccc(-c2ncccc2F)c1)N1CC[C@@]2(O)CCNC[C@H]2C1 |
| InChI | InChI=1S/C20H22FN3O2.ClH/c21-17-5-2-8-23-18(17)14-3-1-4-15(11-14)19(25)24-10-7-20(26)6-9-22-12-16(20)13-24;/h1-5,8,11,16,22,26H,6-7,9-10,12-13H2;1H/t16-,20-;/m0./s1 |
| InChIKey | KWEVTCCDFSKLRI-XXRBRTKDSA-N |
| XLogP | 2.50 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |