C17H21N3O — CID 72930864
(4aS,8aS)-7-isoquinolin-1-yl-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol (PubChem CID 72930864) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is (4aS,8aS)-7-isoquinolin-1-yl-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol.
| Compound Name | (4aS,8aS)-7-isoquinolin-1-yl-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol |
|---|---|
| PubChem CID | 72930864 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (4aS,8aS)-7-isoquinolin-1-yl-1,2,3,4,5,6,8,8a-octahydro-2,7-naphthyridin-4a-ol |
| SMILES | O[C@]12CCNC[C@H]1CN(c1nccc3ccccc13)CC2 |
| InChI | InChI=1S/C17H21N3O/c21-17-6-9-18-11-14(17)12-20(10-7-17)16-15-4-2-1-3-13(15)5-8-19-16/h1-5,8,14,18,21H,6-7,9-12H2/t14-,17-/m0/s1 |
| InChIKey | FBVJJOTYSSMIAA-YOEHRIQHSA-N |
| XLogP | 1.79 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |