C18H21N3O2 — CID 163318749
(6R,11S)-11-hydroxy-8-isoquinolin-1-yl-2,8-diazaspiro[5.5]undecan-1-one (PubChem CID 163318749) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (6R,11S)-11-hydroxy-8-isoquinolin-1-yl-2,8-diazaspiro[5.5]undecan-1-one.
| Compound Name | (6R,11S)-11-hydroxy-8-isoquinolin-1-yl-2,8-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 163318749 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (6R,11S)-11-hydroxy-8-isoquinolin-1-yl-2,8-diazaspiro[5.5]undecan-1-one |
| SMILES | O=C1NCCC[C@]12CN(c1nccc3ccccc13)CC[C@@H]2O |
| InChI | InChI=1S/C18H21N3O2/c22-15-7-11-21(12-18(15)8-3-9-20-17(18)23)16-14-5-2-1-4-13(14)6-10-19-16/h1-2,4-6,10,15,22H,3,7-9,11-12H2,(H,20,23)/t15-,18+/m0/s1 |
| InChIKey | GSDIOCKTMIKGQV-MAUKXSAKSA-N |
| XLogP | 1.70 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |