C24H24N2O3 — CID 164689776
(6R,11R)-8-(anthracene-9-carbonyl)-11-hydroxy-2,8-diazaspiro[5.5]undecan-1-one (PubChem CID 164689776) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (6R,11R)-8-(anthracene-9-carbonyl)-11-hydroxy-2,8-diazaspiro[5.5]undecan-1-one.
| Compound Name | (6R,11R)-8-(anthracene-9-carbonyl)-11-hydroxy-2,8-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 164689776 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (6R,11R)-8-(anthracene-9-carbonyl)-11-hydroxy-2,8-diazaspiro[5.5]undecan-1-one |
| SMILES | O=C(c1c2ccccc2cc2ccccc12)N1CC[C@@H](O)[C@@]2(CCCNC2=O)C1 |
| InChI | InChI=1S/C24H24N2O3/c27-20-10-13-26(15-24(20)11-5-12-25-23(24)29)22(28)21-18-8-3-1-6-16(18)14-17-7-2-4-9-19(17)21/h1-4,6-9,14,20,27H,5,10-13,15H2,(H,25,29)/t20-,24-/m1/s1 |
| InChIKey | WKRFYSCIHQSRCZ-HYBUGGRVSA-N |
| XLogP | 3.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|