C17H29N5O3S — CID 72896549
(4aR,8aR)-7-[(1-cyclopropylimidazol-2-yl)methyl]-4a-hydroxy-N,N-dimethyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridine-2-sulfonamide (PubChem CID 72896549) has the molecular formula C17H29N5O3S and a molecular weight of 383.52 g/mol. Its IUPAC name is (4aR,8aR)-7-[(1-cyclopropylimidazol-2-yl)methyl]-4a-hydroxy-N,N-dimethyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridine-2-sulfonamide.
| Compound Name | (4aR,8aR)-7-[(1-cyclopropylimidazol-2-yl)methyl]-4a-hydroxy-N,N-dimethyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridine-2-sulfonamide |
|---|---|
| PubChem CID | 72896549 |
| Molecular Formula | C17H29N5O3S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (4aR,8aR)-7-[(1-cyclopropylimidazol-2-yl)methyl]-4a-hydroxy-N,N-dimethyl-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridine-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CC[C@]2(O)CCN(Cc3nccn3C3CC3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H29N5O3S/c1-19(2)26(24,25)21-9-6-17(23)5-8-20(11-14(17)12-21)13-16-18-7-10-22(16)15-3-4-15/h7,10,14-15,23H,3-6,8-9,11-13H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | ZSSHGDVWLJMPBK-RHSMWYFYSA-N |
| XLogP | 0.28 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |