C18H28N4O2 — CID 72883256
1-[(4aS,8aS)-4a-hydroxy-7-[(1-methylimidazol-2-yl)methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-3-methylbut-2-en-1-one (PubChem CID 72883256) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[(4aS,8aS)-4a-hydroxy-7-[(1-methylimidazol-2-yl)methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[(4aS,8aS)-4a-hydroxy-7-[(1-methylimidazol-2-yl)methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 72883256 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-[(4aS,8aS)-4a-hydroxy-7-[(1-methylimidazol-2-yl)methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1CC[C@@]2(O)CCN(Cc3nccn3C)C[C@H]2C1 |
| InChI | InChI=1S/C18H28N4O2/c1-14(2)10-17(23)22-8-5-18(24)4-7-21(11-15(18)12-22)13-16-19-6-9-20(16)3/h6,9-10,15,24H,4-5,7-8,11-13H2,1-3H3/t15-,18-/m0/s1 |
| InChIKey | CGHNIWUPDMXBOD-YJBOKZPZSA-N |
| XLogP | 1.17 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|