C9H10N3W- — CID 58914499
1-phenyl-4,5-dihydroimidazol-2-amine;tungsten (PubChem CID 58914499) has the molecular formula C9H10N3W- and a molecular weight of 344.04 g/mol. Its IUPAC name is 1-phenyl-4,5-dihydroimidazol-2-amine;tungsten.
| Compound Name | 1-phenyl-4,5-dihydroimidazol-2-amine;tungsten |
|---|---|
| PubChem CID | 58914499 |
| Molecular Formula | C9H10N3W- |
| Molecular Weight | 344.04 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 1-phenyl-4,5-dihydroimidazol-2-amine;tungsten |
| SMILES | NC1=NCCN1c1cc[c-]cc1.[W] |
| InChI | InChI=1S/C9H10N3.W/c10-9-11-6-7-12(9)8-4-2-1-3-5-8;/h2-5H,6-7H2,(H2,10,11);/q-1; |
| InChIKey | OTYAJMSUJGLULQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.04 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|