About 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten
2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten (PubChem CID 58914527) has the molecular formula C9H8BrN2W-
and a molecular weight of 407.92 g/mol. Its IUPAC name is 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten.
Molecular Properties
| Compound Name | 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten |
| PubChem CID | 58914527 |
| Molecular Formula | C9H8BrN2W- |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 406.94 |
| IUPAC Name | 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten |
| SMILES | BrC1=NCCN1c1cc[c-]cc1.[W] |
| InChI | InChI=1S/C9H8BrN2.W/c10-9-11-6-7-12(9)8-4-2-1-3-5-8;/h2-5H,6-7H2;/q-1; |
| InChIKey | KXGIVSPTJPMEGI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten?
The IUPAC name of 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten (CID 58914527) is 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten.
What is the SMILES notation for 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten?
The canonical SMILES for 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten is BrC1=NCCN1c1cc[c-]cc1.[W].
What is the InChIKey of 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten?
The InChIKey is KXGIVSPTJPMEGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN2.W/c10-9-11-6-7-12(9)8-4-2-1-3-5-8;/h2-5H,6-7H2;/q-1;.
What are the key properties of 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten?
2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten has a molecular weight of 407.92 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-phenyl-4,5-dihydroimidazole;tungsten is sourced from PubChem (CID 58914527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).