C10H11N2W- — CID 58914513
2-methyl-1-phenyl-4,5-dihydroimidazole;tungsten (PubChem CID 58914513) has the molecular formula C10H11N2W- and a molecular weight of 343.05 g/mol. Its IUPAC name is 2-methyl-1-phenyl-4,5-dihydroimidazole;tungsten.
| Compound Name | 2-methyl-1-phenyl-4,5-dihydroimidazole;tungsten |
|---|---|
| PubChem CID | 58914513 |
| Molecular Formula | C10H11N2W- |
| Molecular Weight | 343.05 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-methyl-1-phenyl-4,5-dihydroimidazole;tungsten |
| SMILES | CC1=NCCN1c1cc[c-]cc1.[W] |
| InChI | InChI=1S/C10H11N2.W/c1-9-11-7-8-12(9)10-5-3-2-4-6-10;/h3-6H,7-8H2,1H3;/q-1; |
| InChIKey | SWCKTEBJTIAFQJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.05 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|