C8H15N2+ — CID 66739432
1,2,3,6-tetramethyl-4H-pyrimidin-3-ium (PubChem CID 66739432) has the molecular formula C8H15N2+ and a molecular weight of 139.22 g/mol. Its IUPAC name is 1,2,3,6-tetramethyl-4H-pyrimidin-3-ium.
| Compound Name | 1,2,3,6-tetramethyl-4H-pyrimidin-3-ium |
|---|---|
| PubChem CID | 66739432 |
| Molecular Formula | C8H15N2+ |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.12 |
| IUPAC Name | 1,2,3,6-tetramethyl-4H-pyrimidin-3-ium |
| SMILES | CC1=CC[N+](C)=C(C)N1C |
| InChI | InChI=1S/C8H15N2/c1-7-5-6-9(3)8(2)10(7)4/h5H,6H2,1-4H3/q+1 |
| InChIKey | JQVYTTDTPFPIBQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|