About silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine
silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine (PubChem CID 134859819) has the molecular formula C8H7AgN2
and a molecular weight of 239.03 g/mol. Its IUPAC name is silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine |
| PubChem CID | 134859819 |
| Molecular Formula | C8H7AgN2 |
| Molecular Weight | 239.03 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine |
| SMILES | [Ag+].[H]/[C-]=C1/CN=C2C=CC=CN21 |
| InChI | InChI=1S/C8H7N2.Ag/c1-7-6-9-8-4-2-3-5-10(7)8;/h1-5H,6H2;/q-1;+1 |
| InChIKey | ZICOZVFLVZTEST-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.03 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine?
The IUPAC name of silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine (CID 134859819) is silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine.
What is the SMILES notation for silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine?
The canonical SMILES for silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine is [Ag+].[H]/[C-]=C1/CN=C2C=CC=CN21.
What is the InChIKey of silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine?
The InChIKey is ZICOZVFLVZTEST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2.Ag/c1-7-6-9-8-4-2-3-5-10(7)8;/h1-5H,6H2;/q-1;+1.
What are the key properties of silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine?
silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine has a molecular weight of 239.03 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver 3-methanidylidene-2H-imidazo[1,2-a]pyridine is sourced from PubChem (CID 134859819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).