About CID 134840734
CID 134840734 (PubChem CID 134840734) has the molecular formula C8H7AgN2O2-
and a molecular weight of 271.02 g/mol.
Molecular Properties
| Compound Name | CID 134840734 |
| PubChem CID | 134840734 |
| Molecular Formula | C8H7AgN2O2- |
| Molecular Weight | 271.02 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | — |
| SMILES | [Ag+].[H]/[C-]=C1/CN=C2C=CC=CN21.[O][O-] |
| InChI | InChI=1S/C8H7N2.Ag.O2/c1-7-6-9-8-4-2-3-5-10(7)8;;1-2/h1-5H,6H2;;/q-1;+1;-1 |
| InChIKey | SXYDEXHQHGNLTL-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.02 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 134840734 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134840734?
The IUPAC name of CID 134840734 (CID 134840734) is not available.
What is the SMILES notation for CID 134840734?
The canonical SMILES for CID 134840734 is [Ag+].[H]/[C-]=C1/CN=C2C=CC=CN21.[O][O-].
What is the InChIKey of CID 134840734?
The InChIKey is SXYDEXHQHGNLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2.Ag.O2/c1-7-6-9-8-4-2-3-5-10(7)8;;1-2/h1-5H,6H2;;/q-1;+1;-1.
What are the key properties of CID 134840734?
CID 134840734 has a molecular weight of 271.02 g/mol, XLogP of -0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134840734 is sourced from PubChem (CID 134840734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).