C8H10N2 — CID 45087575
5-methyl-2,3-dihydroimidazo[1,2-a]pyridine (PubChem CID 45087575) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 5-methyl-2,3-dihydroimidazo[1,2-a]pyridine.
| Compound Name | 5-methyl-2,3-dihydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 45087575 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 5-methyl-2,3-dihydroimidazo[1,2-a]pyridine |
| SMILES | CC1=CC=CC2=NCCN12 |
| InChI | InChI=1S/C8H10N2/c1-7-3-2-4-8-9-5-6-10(7)8/h2-4H,5-6H2,1H3 |
| InChIKey | QXLQADGVGZEODD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |