C9H12N2 — CID 142936856
1-[(3E)-hexa-1,3,5-trien-3-yl]-4,5-dihydroimidazole (PubChem CID 142936856) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]-4,5-dihydroimidazole.
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 142936856 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-4,5-dihydroimidazole |
| SMILES | C=C/C=C(\C=C)N1C=NCC1 |
| InChI | InChI=1S/C9H12N2/c1-3-5-9(4-2)11-7-6-10-8-11/h3-5,8H,1-2,6-7H2/b9-5+ |
| InChIKey | YHQWHOXNUWMEDJ-WEVVVXLNSA-N |
| XLogP | 1.59 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|