About 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole
1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole (PubChem CID 23175353) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole |
| PubChem CID | 23175353 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole |
| SMILES | C/C=C(\C)N1C=NCC1 |
| InChI | InChI=1S/C7H12N2/c1-3-7(2)9-5-4-8-6-9/h3,6H,4-5H2,1-2H3/b7-3+ |
| InChIKey | VCPVJUQCKQQDPD-XVNBXDOJSA-N |
| XLogP | 1.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole?
The IUPAC name of 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole (CID 23175353) is 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole.
What is the SMILES notation for 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole?
The canonical SMILES for 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole is C/C=C(\C)N1C=NCC1.
What is the InChIKey of 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole?
The InChIKey is VCPVJUQCKQQDPD-XVNBXDOJSA-N. The full InChI is InChI=1S/C7H12N2/c1-3-7(2)9-5-4-8-6-9/h3,6H,4-5H2,1-2H3/b7-3+.
What are the key properties of 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole?
1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole has a molecular weight of 124.19 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-but-2-en-2-yl]-4,5-dihydroimidazole is sourced from PubChem (CID 23175353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).