C15H28O — CID 141163275
13-methyltetradeca-2,4-dien-5-ol (PubChem CID 141163275) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 13-methyltetradeca-2,4-dien-5-ol.
| Compound Name | 13-methyltetradeca-2,4-dien-5-ol |
|---|---|
| PubChem CID | 141163275 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 13-methyltetradeca-2,4-dien-5-ol |
| SMILES | CC=CC=C(O)CCCCCCCC(C)C |
| InChI | InChI=1S/C15H28O/c1-4-5-12-15(16)13-10-8-6-7-9-11-14(2)3/h4-5,12,14,16H,6-11,13H2,1-3H3 |
| InChIKey | SLCXWARPVGUCRS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|