C12H22N2 — CID 167223912
2-methyl-N'-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]propanimidamide (PubChem CID 167223912) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-methyl-N'-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]propanimidamide.
| Compound Name | 2-methyl-N'-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]propanimidamide |
|---|---|
| PubChem CID | 167223912 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2-methyl-N'-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]propanimidamide |
| SMILES | C/C=C\C=C(/N=C(\N)C(C)C)C(C)C |
| InChI | InChI=1S/C12H22N2/c1-6-7-8-11(9(2)3)14-12(13)10(4)5/h6-10H,1-5H3,(H2,13,14)/b7-6-,11-8- |
| InChIKey | RKCLSWIISOBETG-NJMVCRMVSA-N |
| XLogP | 3.12 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|