C13H12N2O4 — CID 71399502
dimethyl 2,8-dicyanonona-2,4,6-trienedioate (PubChem CID 71399502) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is dimethyl 2,8-dicyanonona-2,4,6-trienedioate.
| Compound Name | dimethyl 2,8-dicyanonona-2,4,6-trienedioate |
|---|---|
| PubChem CID | 71399502 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | dimethyl 2,8-dicyanonona-2,4,6-trienedioate |
| SMILES | COC(=O)C(C#N)=CC=CC=CC(C#N)C(=O)OC |
| InChI | InChI=1S/C13H12N2O4/c1-18-12(16)10(8-14)6-4-3-5-7-11(9-15)13(17)19-2/h3-7,10H,1-2H3 |
| InChIKey | RCAIGOPGHQOKNG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|