C9H12N2O2 — CID 54524751
2-cyano-5-methoxy-N,N-dimethylpenta-2,4-dienamide (PubChem CID 54524751) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-cyano-5-methoxy-N,N-dimethylpenta-2,4-dienamide.
| Compound Name | 2-cyano-5-methoxy-N,N-dimethylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 54524751 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-cyano-5-methoxy-N,N-dimethylpenta-2,4-dienamide |
| SMILES | COC=CC=C(C#N)C(=O)N(C)C |
| InChI | InChI=1S/C9H12N2O2/c1-11(2)9(12)8(7-10)5-4-6-13-3/h4-6H,1-3H3 |
| InChIKey | YSIRNMUMCNTDCP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|