C9H12N2O — CID 123475271
2-acetyl-5-(dimethylamino)penta-2,4-dienenitrile (PubChem CID 123475271) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-acetyl-5-(dimethylamino)penta-2,4-dienenitrile.
| Compound Name | 2-acetyl-5-(dimethylamino)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 123475271 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-acetyl-5-(dimethylamino)penta-2,4-dienenitrile |
| SMILES | CC(=O)C(C#N)=CC=CN(C)C |
| InChI | InChI=1S/C9H12N2O/c1-8(12)9(7-10)5-4-6-11(2)3/h4-6H,1-3H3 |
| InChIKey | HJOSNACCJDNRJX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|