C10H16N4O6S — CID 175229067
2-[1-cyano-4-(dimethylamino)buta-1,3-dienyl]propanediamide;sulfuric acid (PubChem CID 175229067) has the molecular formula C10H16N4O6S and a molecular weight of 320.33 g/mol. Its IUPAC name is 2-[1-cyano-4-(dimethylamino)buta-1,3-dienyl]propanediamide;sulfuric acid.
| Compound Name | 2-[1-cyano-4-(dimethylamino)buta-1,3-dienyl]propanediamide;sulfuric acid |
|---|---|
| PubChem CID | 175229067 |
| Molecular Formula | C10H16N4O6S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[1-cyano-4-(dimethylamino)buta-1,3-dienyl]propanediamide;sulfuric acid |
| SMILES | CN(C)C=CC=C(C#N)C(C(N)=O)C(N)=O.O=S(=O)(O)O |
| InChI | InChI=1S/C10H14N4O2.H2O4S/c1-14(2)5-3-4-7(6-11)8(9(12)15)10(13)16;1-5(2,3)4/h3-5,8H,1-2H3,(H2,12,15)(H2,13,16);(H2,1,2,3,4) |
| InChIKey | CNAPPSYYSGCBLK-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 187.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|