C10H16N2O — CID 163742888
(2E,4E)-5-(dimethylamino)-2-prop-1-en-2-ylpenta-2,4-dienamide (PubChem CID 163742888) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (2E,4E)-5-(dimethylamino)-2-prop-1-en-2-ylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(dimethylamino)-2-prop-1-en-2-ylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 163742888 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (2E,4E)-5-(dimethylamino)-2-prop-1-en-2-ylpenta-2,4-dienamide |
| SMILES | C=C(C)/C(=C\C=C\N(C)C)C(N)=O |
| InChI | InChI=1S/C10H16N2O/c1-8(2)9(10(11)13)6-5-7-12(3)4/h5-7H,1H2,2-4H3,(H2,11,13)/b7-5+,9-6+ |
| InChIKey | LJIBRGQWKFLXIB-PDTNFJSOSA-N |
| XLogP | 1.05 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|