C13H19NO3 — CID 76836198
methyl 2-acetyl-7-(dimethylamino)-4-methylhepta-2,4,6-trienoate (PubChem CID 76836198) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 2-acetyl-7-(dimethylamino)-4-methylhepta-2,4,6-trienoate.
| Compound Name | methyl 2-acetyl-7-(dimethylamino)-4-methylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 76836198 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | methyl 2-acetyl-7-(dimethylamino)-4-methylhepta-2,4,6-trienoate |
| SMILES | COC(=O)C(=CC(C)=CC=CN(C)C)C(C)=O |
| InChI | InChI=1S/C13H19NO3/c1-10(7-6-8-14(3)4)9-12(11(2)15)13(16)17-5/h6-9H,1-5H3 |
| InChIKey | JEDOAIXHJYIASM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|