C10H16NO3+ — CID 2272891
[(1E,3Z)-4-methoxycarbonyl-5-oxohexa-1,3-dienyl]-dimethylazanium (PubChem CID 2272891) has the molecular formula C10H16NO3+ and a molecular weight of 198.24 g/mol. Its IUPAC name is [(1E,3Z)-4-methoxycarbonyl-5-oxohexa-1,3-dienyl]-dimethylazanium.
| Compound Name | [(1E,3Z)-4-methoxycarbonyl-5-oxohexa-1,3-dienyl]-dimethylazanium |
|---|---|
| PubChem CID | 2272891 |
| Molecular Formula | C10H16NO3+ |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | [(1E,3Z)-4-methoxycarbonyl-5-oxohexa-1,3-dienyl]-dimethylazanium |
| SMILES | COC(=O)/C(=C\C=C\[NH+](C)C)C(C)=O |
| InChI | InChI=1S/C10H15NO3/c1-8(12)9(10(13)14-4)6-5-7-11(2)3/h5-7H,1-4H3/p+1/b7-5+,9-6- |
| InChIKey | PRYMZHJRKDKKKR-BEDCHXNXSA-O |
| XLogP | -0.67 |
| TPSA | 47.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|