C9H13NO3 — CID 88913396
methyl (2E,4Z)-5-amino-2-(1-methoxyethenyl)penta-2,4-dienoate (PubChem CID 88913396) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is methyl (2E,4Z)-5-amino-2-(1-methoxyethenyl)penta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-5-amino-2-(1-methoxyethenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 88913396 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | methyl (2E,4Z)-5-amino-2-(1-methoxyethenyl)penta-2,4-dienoate |
| SMILES | C=C(OC)/C(=C\C=C/N)C(=O)OC |
| InChI | InChI=1S/C9H13NO3/c1-7(12-2)8(5-4-6-10)9(11)13-3/h4-6H,1,10H2,2-3H3/b6-4-,8-5+ |
| InChIKey | VTDYEPPZCTXWHW-QXMOYCCXSA-N |
| XLogP | 0.72 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|