C12H12O3S — CID 805471
methyl (2Z,4E)-2-acetyl-5-thiophen-2-ylpenta-2,4-dienoate (PubChem CID 805471) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is methyl (2Z,4E)-2-acetyl-5-thiophen-2-ylpenta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-2-acetyl-5-thiophen-2-ylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 805471 |
| Molecular Formula | C12H12O3S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | methyl (2Z,4E)-2-acetyl-5-thiophen-2-ylpenta-2,4-dienoate |
| SMILES | COC(=O)/C(=C\C=C\c1cccs1)C(C)=O |
| InChI | InChI=1S/C12H12O3S/c1-9(13)11(12(14)15-2)7-3-5-10-6-4-8-16-10/h3-8H,1-2H3/b5-3+,11-7- |
| InChIKey | XRYJIQVVSJHSPV-PGACXJNKSA-N |
| XLogP | 2.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|