About (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid
(2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid (PubChem CID 55255314) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid.
Molecular Properties
| Compound Name | (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid |
| PubChem CID | 55255314 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C\N(C)C)=C(/C(N)=O)C(=O)O |
| InChI | InChI=1S/C9H14N2O3/c1-6(4-5-11(2)3)7(8(10)12)9(13)14/h4-5H,1-3H3,(H2,10,12)(H,13,14)/b5-4-,7-6+ |
| InChIKey | KYEUFWQWVMIVEP-SCFJQAPRSA-N |
| XLogP | -0.05 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid?
The IUPAC name of (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid (CID 55255314) is (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid.
What is the SMILES notation for (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid?
The canonical SMILES for (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid is CC(/C=C\N(C)C)=C(/C(N)=O)C(=O)O.
What is the InChIKey of (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid?
The InChIKey is KYEUFWQWVMIVEP-SCFJQAPRSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-6(4-5-11(2)3)7(8(10)12)9(13)14/h4-5H,1-3H3,(H2,10,12)(H,13,14)/b5-4-,7-6+.
What are the key properties of (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid?
(2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid has a molecular weight of 198.22 g/mol, XLogP of -0.05, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-2-carbamoyl-5-(dimethylamino)-3-methylpenta-2,4-dienoic acid is sourced from PubChem (CID 55255314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).