C6H9N3O3 — CID 155668965
prop-1-ene-1,1,2-tricarboxamide (PubChem CID 155668965) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is prop-1-ene-1,1,2-tricarboxamide.
| Compound Name | prop-1-ene-1,1,2-tricarboxamide |
|---|---|
| PubChem CID | 155668965 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | prop-1-ene-1,1,2-tricarboxamide |
| SMILES | CC(C(N)=O)=C(C(N)=O)C(N)=O |
| InChI | InChI=1S/C6H9N3O3/c1-2(4(7)10)3(5(8)11)6(9)12/h1H3,(H2,7,10)(H2,8,11)(H2,9,12) |
| InChIKey | BPMVFQQWUGGIAV-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|