C4H11N5O — CID 163555683
3,3-dihydrazinyl-2-methylprop-2-enamide (PubChem CID 163555683) has the molecular formula C4H11N5O and a molecular weight of 145.17 g/mol. Its IUPAC name is 3,3-dihydrazinyl-2-methylprop-2-enamide.
| Compound Name | 3,3-dihydrazinyl-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 163555683 |
| Molecular Formula | C4H11N5O |
| Molecular Weight | 145.17 g/mol |
| Exact Mass | 145.10 |
| IUPAC Name | 3,3-dihydrazinyl-2-methylprop-2-enamide |
| SMILES | CC(C(N)=O)=C(NN)NN |
| InChI | InChI=1S/C4H11N5O/c1-2(3(5)10)4(8-6)9-7/h8-9H,6-7H2,1H3,(H2,5,10) |
| InChIKey | FMVJTMPZULFONC-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.17 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|