C4H7NO3 — CID 23369191
3,3-dihydroxy-2-methylprop-2-enamide (PubChem CID 23369191) has the molecular formula C4H7NO3 and a molecular weight of 117.10 g/mol. Its IUPAC name is 3,3-dihydroxy-2-methylprop-2-enamide.
| Compound Name | 3,3-dihydroxy-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 23369191 |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 3,3-dihydroxy-2-methylprop-2-enamide |
| SMILES | CC(C(N)=O)=C(O)O |
| InChI | InChI=1S/C4H7NO3/c1-2(3(5)6)4(7)8/h7-8H,1H3,(H2,5,6) |
| InChIKey | VAQFZWMCIOSGFT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|