C12H17NO — CID 59970557
2,3,6,7-tetramethylocta-2,6-dien-4-ynamide (PubChem CID 59970557) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2,3,6,7-tetramethylocta-2,6-dien-4-ynamide.
| Compound Name | 2,3,6,7-tetramethylocta-2,6-dien-4-ynamide |
|---|---|
| PubChem CID | 59970557 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2,3,6,7-tetramethylocta-2,6-dien-4-ynamide |
| SMILES | CC(C)=C(C)C#CC(C)=C(C)C(N)=O |
| InChI | InChI=1S/C12H17NO/c1-8(2)9(3)6-7-10(4)11(5)12(13)14/h1-5H3,(H2,13,14) |
| InChIKey | GKAKIYGKBPYDRL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|