C8H11NO3 — CID 135304747
(E,2Z)-2-(1-aminoethylidene)-5-oxohex-3-enoic acid (PubChem CID 135304747) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is (E,2Z)-2-(1-aminoethylidene)-5-oxohex-3-enoic acid.
| Compound Name | (E,2Z)-2-(1-aminoethylidene)-5-oxohex-3-enoic acid |
|---|---|
| PubChem CID | 135304747 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (E,2Z)-2-(1-aminoethylidene)-5-oxohex-3-enoic acid |
| SMILES | CC(=O)/C=C/C(C(=O)O)=C(\C)N |
| InChI | InChI=1S/C8H11NO3/c1-5(10)3-4-7(6(2)9)8(11)12/h3-4H,9H2,1-2H3,(H,11,12)/b4-3+,7-6- |
| InChIKey | QUQJXXXGCAQJLF-FDTUMDBZSA-N |
| XLogP | 0.45 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|