C16H11N3O — CID 22095583
(E,4Z)-2-isocyano-4-[(E)-3-methoxyprop-2-enylidene]-3-phenylpent-2-enedinitrile (PubChem CID 22095583) has the molecular formula C16H11N3O and a molecular weight of 261.28 g/mol. Its IUPAC name is (E,4Z)-2-isocyano-4-[(E)-3-methoxyprop-2-enylidene]-3-phenylpent-2-enedinitrile.
| Compound Name | (E,4Z)-2-isocyano-4-[(E)-3-methoxyprop-2-enylidene]-3-phenylpent-2-enedinitrile |
|---|---|
| PubChem CID | 22095583 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (E,4Z)-2-isocyano-4-[(E)-3-methoxyprop-2-enylidene]-3-phenylpent-2-enedinitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(C(/C#N)=C/C=C/OC)\c1ccccc1 |
| InChI | InChI=1S/C16H11N3O/c1-19-15(12-18)16(13-7-4-3-5-8-13)14(11-17)9-6-10-20-2/h3-10H,2H3/b10-6+,14-9+,16-15+ |
| InChIKey | DMSDMCFGGFKSDF-IRKZOQGSSA-N |
| XLogP | 3.45 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|